The [1,1'-Biphenyl]-4-ol,2',3',5',6'-tetrachloro-, with the CAS registry number 14962-32-4, is also known as Phenol, 4-phenyl-2',3',5',6'-tetrachloro-. This chemical's molecular formula is C₁₂H₆Cl₄O and molecular weight is 307.98744. Its IUPAC name is called 4-(2,3,5,6-tetrachlorophenyl)phenol.

Physical properties of [1,1'-Biphenyl]-4-ol,2',3',5',6'-tetrachloro-: (1)ACD/LogP: 4.92; (2)ACD/LogD (pH 5.5): 4.92; (3)ACD/LogD (pH 7.4): 4.89; (4)ACD/BCF (pH 5.5): 3214.09; (5)ACD/BCF (pH 7.4): 3013.13; (6)ACD/KOC (pH 5.5): 11267.88; (7)ACD/KOC (pH 7.4): 10563.33; (8)#H bond acceptors: 1; (9)#H bond donors: 1; (10)#Freely Rotating Bonds: 2; (11)Index of Refraction: 1.638; (12)Molar Refractivity: 72.3 cm³; (13)Molar Volume: 200.9 cm³; (14)Surface Tension: 51.8 dyne/cm; (15)Density: 1.532 g/cm³; (16)Flash Point: 187 °C; (17)Enthalpy of Vaporization: 65.92 kJ/mol; (18)Boiling Point: 385.5 °C at 760 mmHg; (19)Vapour Pressure: 1.7E-06 mmHg at 25°C.

You can still convert the following datas into molecular structure:
(1)Canonical SMILES: C1=CC(=CC=C1C2=C(C(=CC(=C2Cl)Cl)Cl)Cl)O
(2)InChI: InChI=1S/C12H6Cl4O/c13-8-5-9(14)12(16)10(11(8)15)6-1-3-7(17)4-2-6/h1-5,17H
(3)InChIKey: KFRNOFIZNYHJDX-UHFFFAOYSA-N