The CAS registry number of 5-Thiazoleacetic acid,2,4-dimethyl- is 34272-65-6. This chemical is also known as 2,4-Dimethyl-5-thiazoleacetic acid. The molecular formula of it is C₇H₉NO₂S and molecular weight is 171.22. Its IUPAC name is called 2-(2,4-dimethyl-1,3-thiazol-5-yl)acetic acid. This chemical's classification codes are Drug; Therapeutic Agent. This chemical may cause inflammation to the skin or other mucous membranes.

Physical properties about this chemical are: (1)ACD/LogP: 0.85; (2)# of Rule of 5 Violations: 0; (3)ACD/BCF (pH 5.5): 1; (4)ACD/BCF (pH 7.4): 1; (5)ACD/KOC (pH 5.5): 3.14; (6)ACD/KOC (pH 7.4): 1; (7)#H bond acceptors: 3; (8)#H bond donors: 1; (9)#Freely Rotating Bonds: 2; (10)Index of Refraction: 1.572; (11)Molar Refractivity: 43.49 cm³; (12)Molar Volume: 132.1 cm³; (13)Surface Tension: 54 dyne/cm; (14)Density: 1.295 g/cm³; (15)Flash Point: 147.7 °C; (16)Enthalpy of Vaporization: 59.35 kJ/mol; (17)Boiling Point: 320.5 °C at 760 mmHg; (18)Vapour Pressure: 0.000131 mmHg at 25°C.

You can still convert the following datas into molecular structure:
(1)SMILES: O=C(O)Cc1sc(nc1C)C
(2)InChI: InChI=1/C7H9NO2S/c1-4-6(3-7(9)10)11-5(2)8-4/h3H2,1-2H3,(H,9,10)
(3)InChIKey: VVEIGFCSKPLKGZ-UHFFFAOYAT

The toxicity data is as follows: