This chemical is called [3-(Hydrazinecarbonyl)phenyl]boronic acid, and its CAS registry number is 913835-79-7. With the molecular formula of C₇H₉BN₂O₃, its molecular weight is 179.97. Additionally, its product categories are Blocks; Boronic Acids.  

Other characteristics of the [3-(Hydrazinecarbonyl)phenyl]boronic acid can be summarised as followings: (1)#H bond acceptors: 5; (2)#H bond donors: 5; (3)#Freely Rotating Bonds: 5; (4)Polar Surface Area: 95.58 Å²; (5)Index of Refraction: 1.602; (6)Molar Refractivity: 45.3 cm³; (7)Molar Volume: 131.9 cm³; (8)Polarizability: 17.96×10^-24cm³; (9)Surface Tension: 63.8 dyne/cm; (10)Density: 1.36 g/cm³.

You can still convert the following datas into molecular structure:
1.SMILES: B(c1cccc(c1)C(=O)NN)(O)O
2.InChI: InChI=1/C7H9BN2O3/c9-10-7(11)5-2-1-3-6(4-5)8(12)13/h1-4,12-13H,9H2,(H,10,11)
3.InChIKey: NKQNSAXAGLKZBP-UHFFFAOYAG