The CAS registry number of (4,5-Dibromo-2-nitro-cyclohexyl)benzene is 5330-52-9. This chemical's molecular formula is C₁₂H₁₃Br₂NO₂ and molecular weight is 363.0451. What's more, both its IUPAC name and systematic name are the same which is called (4,5-Dibromo-2-nitrocyclohexyl)benzene.

Physical properties about (4,5-Dibromo-2-nitro-cyclohexyl)benzene are: (1)ACD/LogP: 4.03; (2)#of Rule of 5 Violations: 0; (3)#H bond acceptors: 3; (4)#H bond donors: 0; (5)#Freely Rotating Bonds: 2; (6)Polar Surface Area: 45.82Ų; (7)Index of Refraction: 1.616; (8)Molar Refractivity: 73.89 cm³; (9)Molar Volume: 211.3 cm³; (10)Surface Tension: 53.2 dyne/cm; (11)Density: 1.71 g/cm³; (12)Flash Point: 213.1 °C; (13)Enthalpy of Vaporization: 68.39 kJ/mol; (14)Boiling Point: 428.7 °C at 760 mmHg; (15)Vapour Pressure: 1.48E-07 mmHg at 25 °C.

You can still convert the following datas into molecular structure:
(1) SMILES: BrC2CC([N+]([O-])=O)C(c1ccccc1)CC2Br
(2) InChI: InChI=1/C12H13Br2NO2/c13-10-6-9(8-4-2-1-3-5-8)12(15(16)17)7-11(10)14/h1-5,9-12H,6-7H2
(3) InChIKey: ZZMHCBQSLIKVAU-UHFFFAOYAP