The cas register number of (S)-3-Amino-4-(3-chlorophenyl)butyric acid hydrochloride is 270596-38-8. It also can be called as Benzenebutanoic acid, b-amino-3-chloro-, (bS)- and the Systematic name about this chemical is (3S)-3-amino-4-(3-chlorophenyl)butanoic acid hydrochloride. It belongs to the following product categories, such as 3-Amino-4-phenylbutyric Acid Analogs, 3-Amino-4-phenylbutanoic Acid Analogs, API intermediates, B-Amino and so on.

Physical properties about (S)-3-Amino-4-(3-chlorophenyl)butyric acid hydrochloride  are: (1)ACD/LogP: 1.93; (2)ACD/LogD (pH 5.5): -0.57; (3)ACD/LogD (pH 7.4): -0.57; (4)ACD/BCF (pH 5.5): 1; (5)ACD/BCF (pH 7.4): 1; (6)ACD/KOC (pH 5.5): 1; (7)ACD/KOC (pH 7.4): 1; (8)#H bond acceptors: 3; (9)#H bond donors: 3; (10)#Freely Rotating Bonds: 5; (11)Polar Surface Area: 29.54Ų; (12)Enthalpy of Vaporization: 63.93 kJ/mol; (13)Vapour Pressure: 8.13E-06 mmHg at 25°C.

You can still convert the following datas into molecular structure:
(1)SMILES: Clc1cc(ccc1)C[C@H](N)CC(=O)O.Cl
(2)InChI: InChI=1/C10H12ClNO2.ClH/c11-8-3-1-2-7(4-8)5-9(12)6-10(13)14;/h1-4,9H,5-6,12H2,(H,13,14);1H/t9-;/m0./s1
(3)InChIKey: MRFPEMYQUCEGDY-FVGYRXGTBL
(4)Std. InChI: InChI=1S/C10H12ClNO2.ClH/c11-8-3-1-2-7(4-8)5-9(12)6-10(13)14;/h1-4,9H,5-6,12H2,(H,13,14);1H/t9-;/m0./s1
(5)Std. InChIKey: MRFPEMYQUCEGDY-FVGYRXGTSA-N