The 1-(3-Nitorpyridin-2-yl)piperazine with its cas register number is 87394-48-7. It also can be called as Piperazine,1-(3-nitro-2-pyridinyl)- and the IUPAC Name about this chemical is 1-(3-nitropyridin-2-yl)piperazine. It belongs to the following product categories, such as pharmacetical, Pyridines and so on.

Physical properties about 1-(3-Nitorpyridin-2-yl)piperazine are: (1)ACD/LogP: 1.23; (2)#H bond acceptors: 6; (3)#H bond donors: 1; (4)#Freely Rotating Bonds: 2; (5)Polar Surface Area: 65.19Ų; (6)Index of Refraction: 1.583; (7)Molar Refractivity: 54.44 cm³; (8)Molar Volume: 162.7 cm³; (9)Polarizability: 21.58x10^-24cm³; (10)Surface Tension: 54.1 dyne/cm; (11)Enthalpy of Vaporization: 63.7 kJ/mol; (12)Vapour Pressure: 3.2E-06 mmHg at 25°C.

You can still convert the following datas into molecular structure:
(1)Canonical SMILES: C1CN(CCN1)C2=C(C=CC=N2)[N+](=O)[O-]
(2)InChI: InChI=1S/C9H12N4O2/c14-13(15)8-2-1-3-11-9(8)12-6-4-10-5-7-12/h1-3,10H,4-7H2
(3)InChIKey: HSAKGWZDXDRYTB-UHFFFAOYSA-N