The 1,1'-Carbonimidoylbis-1H-imidazole with CAS registry number of 104619-51-4 is also known as 1,1-Di(1H-imidazol-1-yl)methanimine. The IUPAC name is Di(imidazol-1-yl)methanimine. In addition, the formula is C₇H₇N₅ and the molecular weight is 161.16.

Physical properties about 1,1'-Carbonimidoylbis-1H-imidazole are: (1)ACD/BCF (pH 5.5): 1; (2)ACD/BCF (pH 7.4): 1; (3)ACD/KOC (pH 5.5): 7; (4)ACD/KOC (pH 7.4): 7.99; (5)#H bond acceptors: 5; (6)#H bond donors: 1; (7)Index of Refraction: 1.716; (8)Molar Refractivity: 45.63 cm³; (9)Molar Volume: 115.9 cm³; (10)Surface Tension: 65.5 dyne/cm; (11)Density: 1.38 g/cm³; (12)Flash Point: 168.5 °C; (13)Enthalpy of Vaporization: 60.02 kJ/mol; (14)Boiling Point: 355.1 °C at 760 mmHg; (15)Vapour Pressure: 3.21E-05 mmHg at 25 °C.

You can still convert the following datas into molecular structure:
1. Canonical SMILES: C1=CN(C=N1)C(=N)N2C=CN=C2
2. InChI: InChI=1S/C7H7N5/c8-7(11-3-1-9-5-11)12-4-2-10-6-12/h1-6,8H
3. InChIKey: FKGQRXQOODICAT-UHFFFAOYSA-N