The 1-Benzyl-3-methylimidazolium tetrafluoroborate, with the CAS registry number 500996-04-3, is also known as 1-Methyl-3-benzylimidazolium tetrafluoroborate. This chemical's molecular formula is C₁₁H₁₃BF₄N₂ and molecular weight is 260.04. What's more, its systematic name is called 1-Benzyl-3-methyl-1H-imidazol-3-ium fluoride - trifluoroborane (1:1).

Physical properties about 1-Benzyl-3-methylimidazolium tetrafluoroborate are: (1)#H bond acceptors: 2; (2)#H bond donors: 0; (3)#Freely Rotating Bonds: 2.

When you are dealing with this chemical, you should be very careful. This chemical is inflammation to the skin eyes and respiratory system or other mucous membranes. In case of contacting with eyes, you should rinse immediately with plenty of water and seek medical advice.

You can still convert the following datas into molecular structure:
(1) SMILES: [F-].FB(F)F.c1cc(ccc1)Cn2cc[n+](c2)C
(2) InChI: InChI=1/C11H13N2.BF3.FH/c1-12-7-8-13(10-12)9-11-5-3-2-4-6-11;2-1(3)4;/h2-8,10H,9H2,1H3;;1H/q+1;;/p-1
(3) InChIKey: CSXVXMXUQNLCFH-REWHXWOFAV