The 1H-Indene-1-carbonitrile,2,3-dihydro-, with the CAS registry number 26452-97-1, is also known as Indan-1-carbonitrile. Its EINECS registry number is 247-718-2. This chemical's molecular formula is C₁₀H₉N and molecular weight is 143.18516. Its IUPAC name is called 2,3-dihydro-1H-indene-1-carbonitrile.

Physical properties of 1H-Indene-1-carbonitrile,2,3-dihydro-: (1)ACD/LogP: 1.88; (2)ACD/LogD (pH 5.5): 1.88; (3)ACD/LogD (pH 7.4): 1.88; (4)ACD/BCF (pH 5.5): 15.72; (5)ACD/BCF (pH 7.4): 15.72; (6)ACD/KOC (pH 5.5): 250.02; (7)ACD/KOC (pH 7.4): 250.02; (8)#H bond acceptors: 1; (9)Index of Refraction: 1.572; (10)Molar Refractivity: 43.14 cm³; (11)Molar Volume: 131 cm³; (12)Surface Tension: 45.3 dyne/cm; (13)Density: 1.09 g/cm³; (14)Flash Point: 105.6 °C; (15)Enthalpy of Vaporization: 52.84 kJ/mol; (16)Boiling Point: 289.1 °C at 760 mmHg; (17)Vapour Pressure: 0.00224 mmHg at 25°C.

You can still convert the following datas into molecular structure:
(1)Canonical SMILES: C1CC2=CC=CC=C2C1C#N
(2)InChI: InChI=1S/C10H9N/c11-7-9-6-5-8-3-1-2-4-10(8)9/h1-4,9H,5-6H2
(3)InChIKey: CAFXXESJSIBJBZ-UHFFFAOYSA-N