The 2-(4-Ethylbenzoyl)benzoic acid, with the CAS registry number of 1151-14-0, is also known as o-(p-Ethylbenzoyl)benzoic acid. Its EINECS registry number is 214-566-3. This chemical's molecular formula is C₁₆H₁₄O₃ and molecular weight is 254.28. What's more, its IUPAC name is 2-(4-Ethylbenzoyl)benzoic acid.

Physical properties about the 2-(4-Ethylbenzoyl)benzoic acid are: (1)ACD/LogP: 3.30; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 5.5): 1.16; (4)ACD/LogD (pH 7.4): 0.2; (5)ACD/BCF (pH 5.5): 1.37; (6)ACD/BCF (pH 7.4): 1; (7)ACD/KOC (pH 5.5): 10.71; (8)ACD/KOC (pH 7.4): 1.17; (9)#H bond acceptors: 3; (10)#H bond donors: 1; (11)#Freely Rotating Bonds: 4; (12)Polar Surface Area: 43.37 Å²; (13)Index of Refraction: 1.596; (14)Molar Refractivity: 72.52 cm³; (15)Molar Volume: 212.8 cm³; (16)Surface Tension: 49.8 dyne/cm; (17)Density: 1.194 g/cm³; (18)Flash Point: 245.9 °C; (19)Enthalpy of Vaporization: 75.87 kJ/mol; (20)Boiling Point: 459.6 °C at 760 mmHg; (21)Vapour Pressure: 3.06E-09 mmHg at 25 °C.

Uses: it is used to produce other chemicals. For example, it is used to produce 4-(4-Ethyl-phenyl)-2H-phthalazin-1-oneat. This reaction needs reagent N₂H₄*H₂O. Meanwhile, it needs solvent Ethanol. The reaction time is 5 hours. The yield is about 89 %.

You can still convert the following datas into molecular structure:
(1) SMILES:O=C(O)c2ccccc2C(=O)c1ccc(cc1)CC
(2) InChI:InChI=1/C16H14O3/c1-2-11-7-9-12(10-8-11)15(17)13-5-3-4-6-14(13)16(18)19/h3-10H,2H2,1H3,(H,18,19)
(3) InChIKey:JZFDKGFWNSQAHU-UHFFFAOYAQ