The 2-(Chloromethyl)-5-(3-methylphenyl)-1,3,4-oxadiazole, with the CAS registry number 24023-73-2, is also known as 1,3,4-Oxadiazole, 2-(chloromethyl)-5-(3-methylphenyl)-. This chemical's molecular formula is C₁₀H₉ClN₂O and molecular weight is 208.64426. Its IUPAC name is called 2-(chloromethyl)-5-(3-methylphenyl)-1,3,4-oxadiazole. 

Physical properties of 2-(Chloromethyl)-5-(3-methylphenyl)-1,3,4-oxadiazole: (1)ACD/LogP: 1.26; (2)ACD/LogD (pH 5.5): 1.26; (3)ACD/LogD (pH 7.4): 1.26; (4)ACD/BCF (pH 5.5): 5.32; (5)ACD/BCF (pH 7.4): 5.32; (6)ACD/KOC (pH 5.5): 115.16; (7)ACD/KOC (pH 7.4): 115.16; (8)#H bond acceptors: 3; (9)#Freely Rotating Bonds: 2; (10)Index of Refraction: 1.555; (11)Molar Refractivity: 53.91 cm³; (12)Molar Volume: 167.9 cm³; (13)Surface Tension: 45.3 dyne/cm; (14)Density: 1.242 g/cm³; (15)Flash Point: 159.6 °C; (16)Enthalpy of Vaporization: 56.06 kJ/mol; (17)Boiling Point: 340.2 °C at 760 mmHg; (18)Vapour Pressure: 0.000172 mmHg at 25°C.

You can still convert the following datas into molecular structure:
(1)Canonical SMILES: CC1=CC=CC(=C1)C2=NN=C(O2)CCl
(2)InChI: InChI=1S/C10H9ClN2O/c1-7-3-2-4-8(5-7)10-13-12-9(6-11)14-10/h2-5H,6H2,1H3
(3)InChIKey: IBMPKWVAMRQBJJ-UHFFFAOYSA-N