The chemical with CAS registry number of 284477-00-5 is known as 2-(Quinolin-2-yl)acetic acid. The systematic name is Quinolin-2-ylacetic acid. In addition, the formula is C₁₁H₉NO₂ and the molecular weight is 187.19.

Physical properties about 2-(Quinolin-2-yl)acetic acid are: (1)ACD/LogP: 1.37; (2)ACD/LogD (pH 5.5): -0.74; (3)ACD/LogD (pH 7.4): -1.99; (4)ACD/BCF (pH 5.5): 1; (5)ACD/BCF (pH 7.4): 1; (6)ACD/KOC (pH 5.5): 1.02; (7)ACD/KOC (pH 7.4): 1; (8)#H bond acceptors: 3; (9)#H bond donors: 1; (10)#Freely Rotating Bonds: 2; (11)Index of Refraction: 1.66; (12)Molar Refractivity: 53.3 cm³; (13)Molar Volume: 144.2 cm³; (14)Surface Tension: 61.3 dyne/cm; (15)Density: 1.297 g/cm³; (16)Flash Point: 174.6 °C; (17)Enthalpy of Vaporization: 64.5 kJ/mol; (18)Boiling Point: 365.1 °C at 760 mmHg; (19)Vapour Pressure: 5.69E-06 mmHg at 25 °C.

You can still convert the following datas into molecular structure:
1. SMILES: O=C(O)Cc1nc2ccccc2cc1
2. InChI: InChI=1/C11H9NO2/c13-11(14)7-9-6-5-8-3-1-2-4-10(8)12-9/h1-6H,7H2,(H,13,14)
3. InChIKey: FPDPFLYDDGYGKP-UHFFFAOYAM