The 2,3-Pyrazinediamine,5-bromo-N³,N³-dimethyl-, with the CAS registry number 89641-34-9, is also known as 2-Amino-5-bromo-3-(dimethylamino)pyrazine. This chemical's molecular formula is C₆H₉BrN₄ and molecular weight is 217.07. Its systematic name is called 5-bromo-N³,N³-dimethylpyrazine-2,3-diamine.

Physical properties of 2,3-Pyrazinediamine,5-bromo-N³,N³-dimethyl-: (1)ACD/LogP: 3.22; (2)ACD/LogD (pH 5.5): 3.22; (3)ACD/LogD (pH 7.4): 3.22; (4)ACD/BCF (pH 5.5): 165.72; (5)ACD/BCF (pH 7.4): 165.78; (6)ACD/KOC (pH 5.5): 1349.53; (7)ACD/KOC (pH 7.4): 1350.05; (8)#H bond acceptors: 4; (9)#H bond donors: 2; (10)#Freely Rotating Bonds: 1; (11)Index of Refraction: 1.656; (12)Molar Refractivity: 48.67 cm³; (13)Molar Volume: 132.3 cm³; (14)Surface Tension: 63.7 dyne/cm; (15)Density: 1.64 g/cm³; (16)Flash Point: 151.4 °C; (17)Enthalpy of Vaporization: 56.9 kJ/mol; (18)Boiling Point: 326.7 °C at 760 mmHg; (19)Vapour Pressure: 0.000212 mmHg at 25°C.

You can still convert the following datas into molecular structure:
(1)SMILES: Nc1ncc(Br)nc1N(C)C
(2)InChI: InChI=1/C6H9BrN4/c1-11(2)6-5(8)9-3-4(7)10-6/h3H,1-2H3,(H2,8,9)
(3)InChIKey: FBHYHUKOQSACFX-UHFFFAOYAN