The 2,5-Dihydroxy-N-(2-hydroxyethyl)benzamide, with the CAS registry number 61969-53-7, is also known as Benzamide, 2,5-dihydroxy-N-(2-hydroxyethyl)-. Its EINECS registry number is 263-358-9. This chemical's molecular formula is C₉H₁₁NO₄ and molecular weight is 197.19. Its systematic name is called 2,5-dihydroxy-N-(2-hydroxyethyl)benzamide.

Physical properties of 2,5-Dihydroxy-N-(2-hydroxyethyl)benzamide: (1)ACD/LogP: 0.26; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 5.5): 0.26; (4)ACD/LogD (pH 7.4): 0.24; (5)ACD/BCF (pH 5.5): 1; (6)ACD/BCF (pH 7.4): 1; (7)ACD/KOC (pH 5.5): 32.97; (8)ACD/KOC (pH 7.4): 31.8; (9)#H bond acceptors: 5; (10)#H bond donors: 4; (11)#Freely Rotating Bonds: 6; (12)Index of Refraction: 1.626; (13)Molar Refractivity: 49.8 cm³; (14)Molar Volume: 140.6 cm³; (15)Surface Tension: 70 dyne/cm; (16)Density: 1.401 g/cm³; (17)Flash Point: 236 °C; (18)Enthalpy of Vaporization: 76.74 kJ/mol; (19)Boiling Point: 466.6 °C at 760 mmHg; (20)Vapour Pressure: 1.66E-09 mmHg at 25°C.

You can still convert the following datas into molecular structure:
(1)SMILES: O=C(c1cc(O)ccc1O)NCCO
(2)InChI: InChI=1/C9H11NO4/c11-4-3-10-9(14)7-5-6(12)1-2-8(7)13/h1-2,5,11-13H,3-4H2,(H,10,14)
(3)InChIKey: YNCOLLPSNIHBGO-UHFFFAOYAA