This chemical has the systematic name 2,5-Dimethyl-3-nitropyridine, and it is also known as Pyridine, 2,5-dimethyl-3-nitro-. Its molecular formula is C₇H₈N₂O₂ and its molecular weight is 152.15062. The CAS registry number of this chemical is 52381-06-3.

Physical properties of 2,5-Dimethyl-3-nitropyridine are: (1)ACD/LogP: 1.29; (2)ACD/LogD (pH 5.5): 1; (3)ACD/LogD (pH 7.4): 1; (4)ACD/BCF (pH 5.5): 8; (5)ACD/BCF (pH 7.4): 8; (6)ACD/KOC (pH 5.5): 153; (7)ACD/KOC (pH 7.4): 153; (8)#H bond acceptors: 4; (9)#Freely Rotating Bonds: 1; (10)Index of Refraction: 1.551; (11)Molar Refractivity: 40.539 cm³; (12)Molar Volume: 127.049 cm³; (13)Surface Tension: 46.739 dyne/cm; (14)Density: 1.198 g/cm³; (15)Flash Point: 101.158 °C; (16)Enthalpy of Vaporization: 46.12 kJ/mol; (17)Boiling Point: 243.654 °C at 760 mmHg; (18)Vapour Pressure: 0.049 mmHg at 25°C.

Uses of the 2,5-Dimethyl-3-nitropyridine: It could be used to produce the 2,5-dimethyl-3-nitropyridine 1-oxide. This reaction needs the reagent of H₂O₂, and the solvents of benzene, acetic acid. The yield is 68 %.

You can still convert the following datas into molecular structure:
(1)SMILES: O=[N+]([O-])c1cc(C)cnc1C
(2)InChI: InChI=1/C7H8N2O2/c1-5-3-7(9(10)11)6(2)8-4-5/h3-4H,1-2H3
(3)InChIKey: ODTIWFKSSFPXNI-UHFFFAOYAO