The 2,6-Diazaspiro[3.4]octane,6-(phenylmethyl)- has the CAS registry number 135380-28-8. This chemical's molecular formula is C₁₃H₁₈N₂ and molecular weight is 202.3. What's more, its systematic name is 6-benzyl-2,6-diazaspiro[3.4]octane.

Physical properties of 2,6-Diazaspiro[3.4]octane,6-(phenylmethyl)- are: (1)ACD/LogP: 1.62; (2)# of Rule of 5 Violations: 0; (3)#H bond acceptors: 2; (4)#H bond donors: 1; (5)#Freely Rotating Bonds: 2; (6)Polar Surface Area: 15.27 Å²; (7)Index of Refraction: 1.603; (8)Molar Refractivity: 62.62 cm³; (9)Molar Volume: 182.2 cm³; (10)Polarizability: 24.82×10^-24cm³; (11)Surface Tension: 46.5 dyne/cm; (12)Density: 1.11 g/cm³; (13)Flash Point: 128.7 °C; (14)Enthalpy of Vaporization: 54.61 kJ/mol; (15)Boiling Point: 305.7 °C at 760 mmHg; (16)Vapour Pressure: 0.00081 mmHg at 25°C.

You can still convert the following datas into molecular structure:
(1)SMILES: c1ccc(cc1)CN2CCC3(C2)CNC3
(2)InChI: InChI=1S/C13H18N2/c1-2-4-12(5-3-1)8-15-7-6-13(11-15)9-14-10-13/h1-5,14H,6-11H2
(3)InChIKey: FEEPYEXHXJWMAX-UHFFFAOYSA-N