The 2-Phenylimidazo[1,2-a]pyridine-6-boronic acid has the CAS registry number 1187822-25-8. This chemical's molecular formula is C₁₃H₁₁BN₂O₂ and molecular weight is 238.05. What's more, its systematic name is (2-Phenylimidazo[1,2-a]pyridin-6-yl)boronic acid.

Physical properties of 2-Phenylimidazo[1,2-a]pyridine-6-boronic acid are: (1)ACD/LogP: 2.62; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 5.5): 2.004; (4)ACD/LogD (pH 7.4): 2.382; (5)ACD/BCF (pH 5.5): 13.938; (6)ACD/BCF (pH 7.4): 33.321; (7)ACD/KOC (pH 5.5): 152.911; (8)ACD/KOC (pH 7.4): 365.541; (9)#H bond acceptors: 4; (10)#H bond donors: 2; (11)#Freely Rotating Bonds: 4; (12)Polar Surface Area: 57.76 Å²; (13)Index of Refraction: 1.633; (14)Molar Refractivity: 68.358 cm³; (15)Molar Volume: 191.404 cm³; (16)Polarizability: 27.099×10^-24 cm³; (17)Surface Tension: 50.215 dyne/cm; (18)Density: 1.244 g/cm³.

You can still convert the following datas into molecular structure:
(1)SMILES: B(c1ccc2nc(cn2c1)c3ccccc3)(O)O
(2)InChI: InChI=1S/C13H11BN2O2/c17-14(18)11-6-7-13-15-12(9-16(13)8-11)10-4-2-1-3-5-10/h1-9,17-18H
(3)InChIKey: DLVLGGPKNQEEKJ-UHFFFAOYSA-N