The 2-Pyrazinamine,5-methoxy-, with the CAS registry number 54013-07-9, is also known as 2-Amino-5-methoxypyrazine. This chemical's molecular formula is C₅H₇N₃O and molecular weight is 125.058912. Its IUPAC name is called 5-methoxypyrazin-2-amine.

Physical properties of 2-Pyrazinamine,5-methoxy-: (1)ACD/LogP: 0.56; (2)ACD/LogD (pH 5.5): 1; (3)ACD/LogD (pH 7.4): 1; (4)ACD/BCF (pH 5.5): 4; (5)ACD/BCF (pH 7.4): 4; (6)ACD/KOC (pH 5.5): 91; (7)ACD/KOC (pH 7.4): 91; (8)#H bond acceptors: 4; (9)#H bond donors: 2; (10)#Freely Rotating Bonds: 1; (11)Index of Refraction: 1.567; (12)Molar Refractivity: 33.35 cm³; (13)Molar Volume: 102.164 cm³; (14)Surface Tension: 54.885 dyne/cm; (15)Density: 1.225 g/cm³; (16)Flash Point: 110.287 °C; (17)Enthalpy of Vaporization: 49.636 kJ/mol; (18)Boiling Point: 258.749 °C at 760 mmHg; (19)Vapour Pressure: 0.013 mmHg at 25°C.

You can still convert the following datas into molecular structure:
(1)Canonical SMILES: COC1=NC=C(N=C1)N
(2)InChI: InChI=1S/C5H7N3O/c1-9-5-3-7-4(6)2-8-5/h2-3H,1H3,(H2,6,7)
(3)InChIKey: BWXBZAOCBVXFMQ-UHFFFAOYSA-N