The 2-Pyridinamine,N-cyclopropyl-3-nitro-, with the CAS registry number 290313-20-1, is also known as Cyclopropyl(3-nitro(2-pyridyl))amine. This chemical's molecular formula is C₈H₉N₃O₂ and molecular weight is 179.176. Its systematic name is called N-cyclopropyl-3-nitropyridin-2-amine.

Physical properties of 2-Pyridinamine,N-cyclopropyl-3-nitro-: (1)ACD/LogP: 2.13; (2)ACD/LogD (pH 5.5): 2.13; (3)ACD/LogD (pH 7.4): 2.13; (4)ACD/BCF (pH 5.5): 24.48; (5)ACD/BCF (pH 7.4): 24.49; (6)ACD/KOC (pH 5.5): 343.26; (7)ACD/KOC (pH 7.4): 343.46; (8)#H bond acceptors: 5; (9)#H bond donors: 1; (10)#Freely Rotating Bonds: 2; (11)Index of Refraction: 1.701; (12)Molar Refractivity: 47.69 cm³; (13)Molar Volume: 123.2 cm³; (14)Surface Tension: 75.3 dyne/cm; (15)Density: 1.453 g/cm³; (16)Flash Point: 156 °C; (17)Enthalpy of Vaporization: 57.72 kJ/mol; (18)Boiling Point: 334.3 °C at 760 mmHg; (19)Vapour Pressure: 0.000129 mmHg at 25°C.

You can still convert the following datas into molecular structure:
(1)SMILES: [O-][N+](=O)c2cccnc2NC1CC1
(2)InChI: InChI=1/C8H9N3O2/c12-11(13)7-2-1-5-9-8(7)10-6-3-4-6/h1-2,5-6H,3-4H2,(H,9,10)
(3)InChIKey: MPSNZVZFQHGGDP-UHFFFAOYAG