The Imidazo[1,2-a]pyrimidine-2-propanoic acid, with the CAS registry number 956101-01-2, is also known as 3-(4-Hydroimidazo[1,2-a]pyrimidin-2-yl)propanoic acid. This chemical's molecular formula is C₉H₉N₃O₂ and molecular weight is 191.19. What's more, its systematic name is 3-imidazo[1,2-a]pyrimidin-2-ylpropanoic acid.

Physical properties of Imidazo[1,2-a]pyrimidine-2-propanoic acid are: (1)ACD/LogP: 0.03; (2)# of Rule of 5 Violations: 0; (3)#H bond acceptors: 5; (4)#H bond donors: 1; (5)#Freely Rotating Bonds: 3; (6)Polar Surface Area: 67.49 Å²; (7)Index of Refraction: 1.673; (8)Molar Refractivity: 50.69 cm³; (9)Molar Volume: 135.2 cm³; (10)Polarizability: 20.09×10^-24cm³; (11)Surface Tension: 60.5 dyne/cm; (12)Density: 1.41 g/cm³.

You can still convert the following datas into molecular structure:
(1)SMILES: c1cnc2nc(cn2c1)CCC(=O)O
(2)Std. InChI: InChI=1S/C9H9N3O2/c13-8(14)3-2-7-6-12-5-1-4-10-9(12)11-7/h1,4-6H,2-3H2,(H,13,14)
(3)Std. InChIKey: NJQSQSWSNPCGKB-UHFFFAOYSA-N