The CAS registry number of 3,4-Diaminobenzoic acid; sulfuric acid is 1571-69-3. This chemical's molecular formula is C₇H₁₀N₂O₆S and molecular weight is 250.23. What's more, its systematic name is called 3,4-Diaminobenzoic acid sulfate (1:1).

Physical properties about 3,4-Diaminobenzoic acid; sulfuric acid are: (1)ACD/LogP: 0.12; (2)# of Rule of 5 Violations: 1; (3)#H bond acceptors: 4; (4)#H bond donors: 5; (5)#Freely Rotating Bonds: 3; (6)Polar Surface Area: 32.78 Å²; (7)Flash Point: 202.9 °C; (8)Enthalpy of Vaporization: 70.05 kJ/mol; (9)Boiling Point: 411.8 °C at 760 mmHg; (10)Vapour Pressure: 1.61E-07 mmHg at 25 °C.

You can still convert the following datas into molecular structure:
(1) SMILES: O=S(=O)(O)O.O=C(O)c1cc(N)c(N)cc1
(2) InChI: InChI=1/C7H8N2O2.H2O4S/c8-5-2-1-4(7(10)11)3-6(5)9;1-5(2,3)4/h1-3H,8-9H2,(H,10,11);(H2,1,2,3,4)
(3) InChIKey: LJOXMWDVRIBUJM-UHFFFAOYAP