The Pyridine,3,5-dibromo-2-chloro-4-methyl- is an organic compound with the formula C₆H₄Br₂ClN. The IUPAC name of this chemical is 3,5-dibromo-2-chloro-4-methylpyridine. With the CAS registry number 1000017-92-4, it is also named as 2-Chloro-3,5-dibromo-4-methylpyridine. Additionally, the molecular weight is 285.36.

The other characteristics of Pyridine,3,5-dibromo-2-chloro-4-methyl- can be summarized as: (1)ACD/LogP: 3.71; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 5.5): 3.71; (4)ACD/LogD (pH 7.4): 3.71; (5)#H bond acceptors: 1; (6)#H bond donors: 0; (7)#Freely Rotating Bonds: 0; (8)Polar Surface Area: 12.89 Å²; (9)Index of Refraction: 1.606; (10)Molar Refractivity: 49.44 cm³; (11)Molar Volume: 143.2 cm³; (12)Polarizability: 19.6×10^-24 cm³; (13)Surface Tension: 47.4 dyne/cm; (14)Enthalpy of Vaporization: 50.31 kJ/mol; (15)Vapour Pressure: 0.00493 mmHg at 25°C; (16)Exact Mass: 284.837855; (17)MonoIsotopic Mass: 282.839902; (18)Topological Polar Surface Area: 12.9; (19)Heavy Atom Count: 10; (20)Formal Charge: 0; (21)Complexity: 122.

People can use the following data to convert to the molecule structure. 
1. SMILES:Cc1c(cnc(c1Br)Cl)Br
2. InChI:InChI=1/C6H4Br2ClN/c1-3-4(7)2-10-6(9)5(3)8/h2H,1H3 
3. InChIKey:PFKZKCIYLRBYBZ-UHFFFAOYAR
4. Std. InChI:InChI=1S/C6H4Br2ClN/c1-3-4(7)2-10-6(9)5(3)8/h2H,1H3
5. Std. InChIKey:PFKZKCIYLRBYBZ-UHFFFAOYSA-N