The 3-Benzoylbenzyl bromide with its cas register number is 22071-24-5. It also can be called as 3-(Bromomethyl)benzophenone and the IUPAC Name about this chemical is [3-(bromomethyl)phenyl]-phenylmethanone. It belongs to the following product categories, such as Aromatics Compounds, Aromatics, Intermediates and so on.

Physical properties about 3-Benzoylbenzyl bromide are: (1)ACD/LogP: 3.88; (2)ACD/LogD (pH 5.5): 3.88; (3)ACD/LogD (pH 7.4): 3.88; (4)ACD/BCF (pH 5.5): 524.04; (5)ACD/BCF (pH 7.4): 524.04; (6)ACD/KOC (pH 5.5): 3076.96; (7)ACD/KOC (pH 7.4): 3076.96; (8)#H bond acceptors: 1; (9)#Freely Rotating Bonds: 3; (10)Polar Surface Area: 17.07Ų; (11)Index of Refraction: 1.614; (12)Molar Refractivity: 68.69 cm³; (13)Molar Volume: 197 cm³; (14)Polarizability: 27.23x10^-24cm³; (15)Surface Tension: 46.9 dyne/cm; (16) Enthalpy of Vaporization: 63.16 kJ/mol; (17)Vapour Pressure: 4.51E-06 mmHg at 25°C.

You can still convert the following datas into molecular structure:
(1)SMILES: BrCc2cc(C(=O)c1ccccc1)ccc2
(2)InChI: InChI=1/C14H11BrO/c15-10-11-5-4-8-13(9-11)14(16)12-6-2-1-3-7-12/h1-9H,10H2
(3)InChIKey: SZJQXQICJDHRJE-UHFFFAOYAF
(4)Std. InChI: InChI=1S/C14H11BrO/c15-10-11-5-4-8-13(9-11)14(16)12-6-2-1-3-7-12/h1-9H,10H2
(5)Std. InChIKey: SZJQXQICJDHRJE-UHFFFAOYSA-N