The Thiophene,3-bromo-2-nitro-, with the CAS registry number 24430-27-1, is also known as 3-Bromo-2-nitro thiophene. This chemical's molecular formula is C₄H₂BrNO₂S and molecular weight is 208.03318. Its IUPAC name is called 3-bromo-2-nitrothiophene. 

Physical properties of Thiophene,3-bromo-2-nitro-: (1)ACD/LogP: 2.17; (2)ACD/LogD (pH 5.5): 2.17; (3)ACD/LogD (pH 7.4): 2.17; (4)ACD/BCF (pH 5.5): 26.26; (5)ACD/BCF (pH 7.4): 26.26; (6)ACD/KOC (pH 5.5): 361; (7)ACD/KOC (pH 7.4): 361; (8)#H bond acceptors: 3; (9)#Freely Rotating Bonds: 1; (10)Index of Refraction: 1.647; (11)Molar Refractivity: 38.87 cm³; (12)Molar Volume: 106.9 cm³; (13)Surface Tension: 59 dyne/cm; (14)Density: 1.945 g/cm³; (15)Flash Point: 92.1 °C; (16)Enthalpy of Vaporization: 44.63 kJ/mol; (17)Boiling Point: 228.6 °C at 760 mmHg; (18)Vapour Pressure: 0.11 mmHg at 25°C.

You can still convert the following datas into molecular structure:
(1)SMILES: [O-][N+](=O)c1sccc1Br
(2)InChI: InChI=1/C4H2BrNO2S/c5-3-1-2-9-4(3)6(7)8/h1-2H
(3)InChIKey: UYIHKIRPUMUUJX-UHFFFAOYAG