The 2-Pyridinecarboxylicacid, 3-methoxy-, methyl ester, with the CAS registry number 24059-83-4, is also known as Methyl 3-methoxypyridine-2-carboxylate. This chemical's molecular formula is C₈H₉NO₃ and molecular weight is 167.162. Its systematic name is called methyl 3-methoxypyridine-2-carboxylate. 

Physical properties of 2-Pyridinecarboxylicacid, 3-methoxy-, methyl ester: (1)ACD/LogP: 0.78; (2)ACD/LogD (pH 5.5): 0.78; (3)ACD/LogD (pH 7.4): 0.78; (4)ACD/BCF (pH 5.5): 2.32; (5)ACD/BCF (pH 7.4): 2.32; (6)ACD/KOC (pH 5.5): 63.52; (7)ACD/KOC (pH 7.4): 63.53; (8)#H bond acceptors: 4; (9)#H bond donors: 0; (10)#Freely Rotating Bonds: 3; (11)Index of Refraction: 1.503; (12)Molar Refractivity: 42.79 cm³; (13)Molar Volume: 144.5 cm³; (14)Surface Tension: 39.7 dyne/cm; (15)Density: 1.156 g/cm³; (16)Flash Point: 123.4 °C; (17)Enthalpy of Vaporization: 51.91 kJ/mol; (18)Boiling Point: 280.4 °C at 760 mmHg; (19)Vapour Pressure: 0.0038 mmHg at 25°C.

You can still convert the following datas into molecular structure:
(1)SMILES: O=C(OC)c1ncccc1OC
(2)InChI: InChI=1/C8H9NO3/c1-11-6-4-3-5-9-7(6)8(10)12-2/h3-5H,1-2H3
(3)InChIKey: KSXQRYUHBMAREL-UHFFFAOYAD