The Cyclohexanone,3-phenyl- has the CAS registry number 20795-53-3. This chemical's molecular formula is C₁₂H₁₄O and molecular weight is 174.24. What's more, its systematic name is 3-phenylcyclohexanone. 

Physical properties of Cyclohexanone,3-phenyl- are: (1)ACD/LogP: 2.37; (2)# of Rule of 5 Violations: 0; (3)#H bond acceptors: 1; (4)#H bond donors: 0; (5)#Freely Rotating Bonds: 1; (6)Polar Surface Area: 17.07 Å²; (7)Index of Refraction: 1.537; (8)Molar Refractivity: 52.24 cm³; (9)Molar Volume: 167.1 cm³; (10)Polarizability: 20.71×10^-24cm³; (11)Surface Tension: 38.9 dyne/cm; (12)Density: 1.042 g/cm³; (13)Flash Point: 123.7 °C; (14)Enthalpy of Vaporization: 53.36 kJ/mol; (15)Boiling Point: 294 °C at 760 mmHg; (16)Vapour Pressure: 0.00167 mmHg at 25°C.

You can still convert the following datas into molecular structure:
(1)SMILES: O=C2CC(c1ccccc1)CCC2
(2)InChI: InChI=1S/C12H14O/c13-12-8-4-7-11(9-12)10-5-2-1-3-6-10/h1-3,5-6,11H,4,7-9H2
(3)InChIKey: CJAUDSQXFVZPTO-UHFFFAOYSA-N