The 3H-2, 1-Benzoxathiole, 1, 1-dioxide, with the CAS registry number of 4430-23-3, is also known as 1, 1-Dioxide-3H-2, 1-benzoxathiole. Its EINECS registry number is 224-620-8. This chemical's molecular formula is C₇H₆O₃S and molecular weight is 170.18574. What's more, its systematic name is called 3H-2, 1-Benzoxathiole 1, 1-dioxide.

Physical properties about 3H-2, 1-Benzoxathiole, 1, 1-dioxide are: (1)ACD/LogP: 0.52; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 5.5): 0.52; (4)ACD/LogD (pH 7.4): 0.52; (5)ACD/BCF (pH 5.5): 1.46; (6)ACD/BCF (pH 7.4): 1.46; (7)ACD/KOC (pH 5.5): 45.61; (8)ACD/KOC (pH 7.4): 45.61; (9)#H bond acceptors: 3; (10)#H bond donors: 0; (11)#Freely Rotating Bonds: 0; (12)Polar Surface Area: 51.75 Å²; (13)Index of Refraction: 1.602; (14)Molar Refractivity: 39.89 cm³; (15)Molar Volume: 116.1 cm³; (16)Surface Tension: 51.1 dyne/cm; (17)Density: 1.465 g/cm³; (18)Flash Point: 141.7 °C; (19)Enthalpy of Vaporization: 52.95 kJ/mol; (20)Boiling Point: 310.7 °C at 760 mmHg; (21)Vapour Pressure: 0.00108 mmHg at 25 °C.

Uses: it is used to produce other chemicals. For example, it is used to produce 2-Methyl-3-(2-sulfobenzyl)benzothiazolium betaine. The reaction time is 4 hours with reaction temperature of 150 °C. The yield is about 78 %.

You can still convert the following datas into molecular structure:
(1) SMILES: O=S2(=O)OCc1ccccc12
(2) InChI: InChI=1/C7H6O3S/c8-11(9)7-4-2-1-3-6(7)5-10-11/h1-4H,5H2
(3) InChIKey: SDJPPXJZWJEAPT-UHFFFAOYAN