The 4-(6-Acryloxyhexyl-1-oxy)benzoic acid with CAS registry number of 83883-26-5 is also known as Benzoic acid, 4-[[6-[(1-oxo-2-propen-1-yl)oxy]hexyl]oxy]-. The systematic name is 4-{[6-(Acryloyloxy)hexyl]oxy}benzoic acid. In addition, the formula is C₁₆H₂₀O₅ and the molecular weight is 292.33.

Physical properties about 4-(6-Acryloxyhexyl-1-oxy)benzoic acid are: (1)ACD/LogP: 4.12; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 5.5): 3.06; (4)ACD/LogD (pH 7.4): 1.4; (5)ACD/BCF (pH 5.5): 69.7; (6)ACD/BCF (pH 7.4): 1.52; (7)ACD/KOC (pH 5.5): 362.75; (8)ACD/KOC (pH 7.4): 7.9; (9)#H bond acceptors: 5; (10)#H bond donors: 1; (11)#Freely Rotating Bonds: 11; (12)Index of Refraction: 1.523; (13)Molar Refractivity: 78.42 cm³; (14)Molar Volume: 256.5 cm³; (15)Surface Tension: 43.2 dyne/cm; (16)Density: 1.139 g/cm³; (17)Flash Point: 160.4 °C; (18)Enthalpy of Vaporization: 74.31 kJ/mol; (19)Boiling Point: 446.9 °C at 760 mmHg; (20)Vapour Pressure: 9.03E-09 mmHg at 25 °C.

You can still convert the following datas into molecular structure:
1. SMILES: O=C(O)c1ccc(OCCCCCCOC(=O)\C=C)cc1
2. InChI: InChI=1/C16H20O5/c1-2-15(17)21-12-6-4-3-5-11-20-14-9-7-13(8-10-14)16(18)19/h2,7-10H,1,3-6,11-12H2,(H,18,19)
3. InChIKey: FLPSQLAEXYKMGQ-UHFFFAOYAG