The 4-(Aminomethyl)octane-1,8-diamine, with the CAS registry number 1572-55-0, is also known as 1,8-Diamino-4-aminomethyloctane. Its EINECS number is 216-392-3. This chemical's molecular formula is C₉H₂₃N₃ and molecular weight is 173.30. What's more, its systematic name is 4-(Aminomethyl)-1,8-octanediamine.

Physical properties of 4-(Aminomethyl)octane-1,8-diamine are: (1)ACD/LogP: 0.07; (2)# of Rule of 5 Violations: 1; (3)ACD/LogD (pH 5.5): -5.03; (4)ACD/LogD (pH 7.4): -5.01; (5)ACD/BCF (pH 5.5): 1.00; (6)ACD/BCF (pH 7.4): 1.00; (7)ACD/KOC (pH 5.5): 1.00; (8)ACD/KOC (pH 7.4): 1.00; (9)#H bond acceptors: 3; (10)#H bond donors: 6; (11)#Freely Rotating Bonds: 11; (12)Polar Surface Area: 78.06 Å²; (13)Index of Refraction: 1.488; (14)Molar Refractivity: 54.309 cm³; (15)Molar Volume: 188.505 cm³; (16)Polarizability: 21.53×10^-24cm³; (17)Surface Tension: 40.2 dyne/cm; (18)Density: 0.919 g/cm³; (19)Flash Point: 167.213 °C; (20)Enthalpy of Vaporization: 57.278 kJ/mol; (21)Boiling Point: 330.227 °C at 760 mmHg; (22)Vapour Pressure: 0 mmHg at 25°C.

You can still convert the following datas into molecular structure:
(1)SMILES: NCCCC(CCCCN)CN
(2)Std. InChI: InChI=1S/C9H23N3/c10-6-2-1-4-9(8-12)5-3-7-11/h9H,1-8,10-12H2
(3)Std. InChIKey: HMJBXEZHJUYJQY-UHFFFAOYSA-N

The toxicity data is as follows: