The 4-(Methoxymethyl)phenol, with the CAS registry number 5355-17-9, is also known as alpha-Methoxy-p-cresol and Phenol, 4-(methoxymethyl)-. Its EINECS registry number is 226-334-9. This chemical's molecular formula is C₈H₁₀O₂ and molecular weight is 138.1638. Its IUPAC name and systematic name are the same which is called 4-(methoxymethyl)phenol.

Physical properties about 4-(Methoxymethyl)phenol are: (1)ACD/LogP: 1.22; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 5.5): 1.22; (4)ACD/LogD (pH 7.4): 1.22; (5)ACD/BCF (pH 5.5): 4.99; (6)ACD/BCF (pH 7.4): 4.97; (7)ACD/KOC (pH 5.5): 109.94; (8)ACD/KOC (pH 7.4): 109.55; (9)#H bond acceptors: 2; (10)#H bond donors: 1; (11)#Freely Rotating Bonds: 3; (12)Index of Refraction: 1.532; (13)Molar Refractivity: 39.42 cm³; (14)Molar Volume: 127 cm³; (15)Surface Tension: 39.5 dyne/cm; (16)Density: 1.087 g/cm³; (17)Flash Point: 92.5 °C; (18)Enthalpy of Vaporization: 47.79 kJ/mol; (19)Boiling Point: 222.8 °C at 760 mmHg; (20)Vapour Pressure: 0.067 mmHg at 25°C.

You can still convert the following datas into molecular structure:
(1)Canonical SMILES: COCC1=CC=C(C=C1)O
(2)InChI: InChI=1S/C8H10O2/c1-10-6-7-2-4-8(9)5-3-7/h2-5,9H,6H2,1H3
(3)InChIKey: AHXXIALEMINDAW-UHFFFAOYSA-N