The 4,5,9,10-Tetraazaphenanthrene, with the CAS registry number 653-05-4, is also known as ZINC05897118. This chemical's molecular formula is C₁₀H₆N₄ and molecular weight is 182.18144. Its systematic name is called dipyrido[3,2-c:2',3'-e]pyridazine. 

Physical properties of 4,5,9,10-Tetraazaphenanthrene: (1)ACD/LogP: -0.19; (2)ACD/LogD (pH 5.5): -0.19; (3)ACD/LogD (pH 7.4): -0.19; (4)ACD/BCF (pH 5.5): 1; (5)ACD/BCF (pH 7.4): 1; (6)ACD/KOC (pH 5.5): 18.79; (7)ACD/KOC (pH 7.4): 18.79; (8)#H bond acceptors: 4; (9)Index of Refraction: 1.77; (10)Molar Refractivity: 54.3 cm³; (11)Molar Volume: 130.5 cm³; (12)Surface Tension: 80.8 dyne/cm; (13)Density: 1.395 g/cm³; (14)Flash Point: 219.6 °C; (15)Enthalpy of Vaporization: 62.07 kJ/mol; (16)Boiling Point: 395.7 °C at 760 mmHg; (17)Vapour Pressure: 4.11E-06 mmHg at 25°C.

You can still convert the following datas into molecular structure:
(1)Canonical SMILES: C1=CC2=C(C3=C(C=CC=N3)N=N2)N=C1
(2)InChI: InChI=1S/C10H6N4/c1-3-7-9(11-5-1)10-8(14-13-7)4-2-6-12-10/h1-6H
(3)InChIKey: QMFMZFPFIUREDE-UHFFFAOYSA-N