The 4,6-Pyrimidinediamine,hydrochloride (1:1), with the CAS registry number 5468-67-7, is also known as 4,6-Pyrimidinediamine, monohydrochloride. Its EINECS registry number is 226-788-8. This chemical's molecular formula is C₄H₇ClN₄ and molecular weight is 146.035924. Its IUPAC name is called pyrimidine-4,6-diamine hydrochloride.

Physical properties of 4,6-Pyrimidinediamine,hydrochloride (1:1): (1)ACD/LogP: -0.13; (2)ACD/LogD (pH 5.5): -0.74; (3)ACD/LogD (pH 7.4): -0.14; (4)ACD/BCF (pH 5.5): 1; (5)ACD/BCF (pH 7.4): 1; (6)ACD/KOC (pH 5.5): 4.96; (7)ACD/KOC (pH 7.4): 19.56; (8)#H bond acceptors: 4; (9)#H bond donors: 4; (10)Flash Point: 201.5 °C; (11)Enthalpy of Vaporization: 61.02 kJ/mol; (12)Boiling Point: 364 °C at 760 mmHg; (13)Vapour Pressure: 1.73E-05 mmHg at 25°C.

You can still convert the following datas into molecular structure:
(1)Canonical SMILES: C1=C(N=CN=C1N)N.Cl
(2)InChI: InChI=1S/C4H6N4.ClH/c5-3-1-4(6)8-2-7-3;/h1-2H,(H4,5,6,7,8);1H
(3)InChIKey: MVZWLBUGTZKZMN-UHFFFAOYSA-N