The CAS registry number of 4-Bromo-3-hydroxybenzaldehyde is 20035-32-9. This chemical's molecular formula is C₇H₅BrO₂ and molecular weight is 201.0174. Its systematic name is called 4-bromo-3-hydroxybenzaldehyde.

Physical properties of 4-Bromo-3-hydroxybenzaldehyde: (1)ACD/LogP: 2.17; (2)ACD/LogD (pH 5.5): 2; (3)ACD/LogD (pH 7.4): 2; (4)ACD/BCF (pH 5.5): 39; (5)ACD/BCF (pH 7.4): 26; (6)ACD/KOC (pH 5.5): 478; (7)ACD/KOC (pH 7.4): 322; (8)#H bond acceptors: 2; (9)#H bond donors: 1; (10)#Freely Rotating Bonds: 2; (11)Index of Refraction: 1.657; (12)Molar Refractivity: 42.578 cm³; (13)Molar Volume: 115.714 cm³; (14)Surface Tension: 56.924 dyne/cm; (15)Density: 1.737 g/cm³; (16)Flash Point: 114.087 °C; (17)Enthalpy of Vaporization: 52.322 kJ/mol; (18)Boiling Point: 265.03 °C at 760 mmHg; (19)Vapour Pressure: 0.006 mmHg at 25°C.

You can still convert the following datas into molecular structure:
(1)SMILES: Oc1cc(C=O)ccc1Br
(2)InChI: InChI=1/C7H5BrO2/c8-6-2-1-5(4-9)3-7(6)10/h1-4,10H
(3)InChIKey: USCBCBWUZOPHNV-UHFFFAOYAM