The Pyridine,4-bromo-3-phenyl-, with the CAS registry number 440112-20-9, has the molecular formula C₁₁H₈BrN. Besides, its molecular weight is 234.0919. Its systematic name is called 4-bromo-3-phenylpyridine.

Physical properties of Pyridine,4-bromo-3-phenyl-: (1)ACD/LogP: 3.27; (2)ACD/LogD (pH 5.5): 3.27; (3)ACD/LogD (pH 7.4): 3.27; (4)ACD/BCF (pH 5.5): 179.34; (5)ACD/BCF (pH 7.4): 180.38; (6)ACD/KOC (pH 5.5): 1425.78; (7)ACD/KOC (pH 7.4): 1434.12; (8)#H bond acceptors: 1; (9)#Freely Rotating Bonds: 1; (10)Index of Refraction: 1.606; (11)Molar Refractivity: 56.62 cm³; (12)Molar Volume: 164.1 cm³; (13)Surface Tension: 45 dyne/cm; (14)Density: 1.426 g/cm³; (15)Flash Point: 146.2 °C; (16)Enthalpy of Vaporization: 53.73 kJ/mol; (17)Boiling Point: 318.1 °C at 760 mmHg; (18)Vapour Pressure: 0.000689 mmHg at 25°C.

You can still convert the following datas into molecular structure:
(1)SMILES: Brc2ccncc2c1ccccc1
(2)InChI: InChI=1/C11H8BrN/c12-11-6-7-13-8-10(11)9-4-2-1-3-5-9/h1-8H
(3)InChIKey: PJQXGXWAGCCGKK-UHFFFAOYAB