The systematic name of this chemical is 4-bromothiophene-3-carboxylic acid. With the CAS registry number 16694-17-0 and EINECS 240-739-8, it is also named as 4-Bromo-3-thenoic acid. The product's categories are Carboxy; Organohalides; Thiophene. The formula is C₅H₃BrO₂S and the molecular weight is 207.05.

The other characteristics of 4-Bromothiophene-3-carboxylic acid can be summarized as: (1)ACD/LogP: 1.71; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 5.5): -0.14; (4)ACD/LogD (pH 7.4): -1.35; (5)ACD/BCF (pH 5.5): 1; (6)ACD/BCF (pH 7.4): 1; (7)ACD/KOC (pH 5.5): 2.85; (8)ACD/KOC (pH 7.4): 1; (9)#H bond acceptors: 2; (10)#H bond donors: 1; (11)#Freely Rotating Bonds: 1; (12)Polar Surface Area: 54.54 Å²; (13)Index of Refraction: 1.65; (14)Molar Refractivity: 39.25 cm³; (15)Molar Volume: 107.6 cm³; (16)Polarizability: 15.56×10^-24 cm³; (17)Surface Tension: 62.8 dyne/cm; (18)Density: 1.923 g/cm³; (19)Flash Point: 146.1 °C; (20)Enthalpy of Vaporization: 59.06 kJ/mol; (21)Boiling Point: 318 °C at 760 mmHg; (22)Vapour Pressure: 0.000156 mmHg at 25°C.

People can use the following data to convert to the molecule structure. 
1. SMILES:Brc1cscc1C(=O)O
2. InChI:InChI=1/C5H3BrO2S/c6-4-2-9-1-3(4)5(7)8/h1-2H,(H,7,8)
3. InChIKey:APBIZVFQQBCAAT-UHFFFAOYAA
4. Std. InChI:InChI=1S/C5H3BrO2S/c6-4-2-9-1-3(4)5(7)8/h1-2H,(H,7,8)
5. Std. InChIKey:APBIZVFQQBCAAT-UHFFFAOYSA-N