The 4-Bromobenzo[d]isoxazole, with the CAS registry number 1126848-34-7, is also known as 1,2-Benzisoxazole, 4-bromo-. This chemical's molecular formula is C₇H₄BrNO and molecular weight is 198.01676. Its systematic name is called 4-bromo-1,2-benzoxazole.

Physical properties of 4-Bromobenzo[d]isoxazole: (1)ACD/LogP: 2.78; (2)ACD/LogD (pH 5.5): 2.784; (3)ACD/LogD (pH 7.4): 2.784; (4)ACD/BCF (pH 5.5): 76.847; (5)ACD/BCF (pH 7.4): 76.847; (6)ACD/KOC (pH 5.5): 778.649; (7)ACD/KOC (pH 7.4): 778.649; (8)#H bond acceptors: 2; (9)Index of Refraction: 1.649; (10)Molar Refractivity: 42.176 cm³; (11)Molar Volume: 115.752 cm³; (12)Surface Tension: 51.264 dyne/cm; (13)Density: 1.711 g/cm³; (14)Flash Point: 120.794 °C; (15)Enthalpy of Vaporization: 49.392 kJ/mol; (16)Boiling Point: 276.122 °C at 760 mmHg; (17)Vapour Pressure: 0.008 mmHg at 25°C.

You can still convert the following datas into molecular structure:
(1)SMILES: c1cc2c(cno2)c(c1)Br
(2)InChI: InChI=1/C7H4BrNO/c8-6-2-1-3-7-5(6)4-9-10-7/h1-4H
(3)InChIKey: WPERWOJBMXTKKG-UHFFFAOYAT