The CAS registry number of 5-Thiazolecarboxaldehyde,4-chloro- is 104146-17-0. This chemical is also known as 5-Thiazolecarboxaldehyde, 4-chloro- (9CI). The molecular formula of it is C₄H₂ClNOS and molecular weight is 147.58. Its systematic name is called 4-chloro-1,3-thiazole-5-carbaldehyde.

Physical properties about 5-Thiazolecarboxaldehyde,4-chloro- are: (1)ACD/LogP: 0.32; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 5.5): 1; (4)ACD/LogD (pH 7.4): 1; (5)ACD/BCF (pH 5.5): 2; (6)ACD/BCF (pH 7.4): 2; (7)ACD/KOC (pH 5.5): 48; (8)ACD/KOC (pH 7.4): 48; (9)#H bond acceptors: 2; (10)#H bond donors: 0; (11)#Freely Rotating Bonds: 1; (12)Index of Refraction: 1.637; (13)Molar Refractivity: 34.376 cm³; (14)Molar Volume: 95.753 cm³; (15)Surface Tension: 59.115 dyne/cm; (16)Density: 1.541 g/cm³; (17)Flash Point: 107.795 °C; (18)Enthalpy of Vaporization: 49.206 kJ/mol; (19)Boiling Point: 254.627 °C at 760 mmHg; (20)Vapour Pressure: 0.017 mmHg at 25°C.

You can still convert the following datas into molecular structure:
(1)SMILES: O=Cc1scnc1Cl
(2)InChI: InChI=1/C4H2ClNOS/c5-4-3(1-7)8-2-6-4/h1-2H
(3)InChIKey: GJTWEAFBOIYNLZ-UHFFFAOYAC