The Benzeneaceticacid, 3-formyl-4-hydroxy-, methyl ester with CAS registry number of 61874-04-2 is also known as 4-Hydroxy-3-carboxaldehydeacetic acid methyl ester. The systematic name is Methyl 2-(3-formyl-4-hydroxyphenyl)acetate. In addition, the formula is C₁₀H₁₀O₄ and the molecular weight is 194.18.

Physical properties about Benzeneaceticacid, 3-formyl-4-hydroxy-, methyl ester are: (1)ACD/LogP: 1.36; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 5.5): 1.35; (4)ACD/LogD (pH 7.4): 1.25; (5)#H bond acceptors: 4; (6)#H bond donors: 1; (7)#Freely Rotating Bonds: 5; (8)Index of Refraction: 1.582; (9)Molar Refractivity: 50.84 cm³; (10)Molar Volume: 152.3 cm³; (11)Surface Tension: 51.6 dyne/cm; (12)Density: 1.274 g/cm³; (13)Flash Point: 116.6 °C; (14)Enthalpy of Vaporization: 56.19 kJ/mol; (15)Boiling Point: 300.2 °C at 760 mmHg; (16)Vapour Pressure: 0.000637 mmHg at 25 °C.

You can still convert the following datas into molecular structure:
1. SMILES:O=Cc1cc(ccc1O)CC(=O)OC
2. InChI:InChI=1/C10H10O4/c1-14-10(13)5-7-2-3-9(12)8(4-7)6-11/h2-4,6,12H,5H2,1H3
3. InChIKey:NUMJEIDLAXIVPL-UHFFFAOYAN
4. Std. InChI:InChI=1S/C10H10O4/c1-14-10(13)5-7-2-3-9(12)8(4-7)6-11/h2-4,6,12H,5H2,1H3
5. Std. InChIKey:NUMJEIDLAXIVPL-UHFFFAOYSA-N