The 4-Hydroxyphenanthrene, with the CAS registry number 7651-86-7, is also known as 4-Phenanthrenol. Its EINECS registry number is 231-613-3. This chemical's molecular formula is C₁₄H₁₀O and molecular weight is 194.2286. Its IUPAC name is called phenanthren-4-ol.

Physical properties of 4-Hydroxyphenanthrene: (1)ACD/LogP: 3.94; (2)ACD/LogD (pH 5.5): 3.94; (3)ACD/LogD (pH 7.4): 3.94; (4)ACD/BCF (pH 5.5): 584.65; (5)ACD/BCF (pH 7.4): 578.94; (6)ACD/KOC (pH 5.5): 3327.6; (7)ACD/KOC (pH 7.4): 3295.09; (8)#H bond acceptors: 1; (9)#H bond donors: 1; (10)#Freely Rotating Bonds: 1; (11)Index of Refraction: 1.753; (12)Molar Refractivity: 63.81 cm³; (13)Molar Volume: 156 cm³; (14)Surface Tension: 57.5 dyne/cm; (15)Density: 1.244 g/cm³; (16)Flash Point: 197.7 °C; (17)Enthalpy of Vaporization: 68.15 kJ/mol; (18)Boiling Point: 404.5 °C at 760 mmHg; (19)Vapour Pressure: 4.02E-07 mmHg at 25°C.

You can still convert the following datas into molecular structure:
(1)Canonical SMILES: C1=CC=C2C(=C1)C=CC3=C2C(=CC=C3)O
(2)InChI: InChI=1S/C14H10O/c15-13-7-3-5-11-9-8-10-4-1-2-6-12(10)14(11)13/h1-9,15H
(3)InChIKey: SIMYIUXARJLHEA-UHFFFAOYSA-N