The 5,6,7,8-Tetrahydro-1,6-naphthyridin-3-amine, with the CAS registry number 948306-78-3, is also known as 1,6-Naphthyridin-3-amine, 5,6,7,8-tetrahydro-. This chemical's molecular formula is C₈H₁₁N₃ and molecular weight is 149.19. Its systematic name is called 5,6,7,8-tetrahydro-1,6-naphthyridin-3-amine.

Physical properties of 5,6,7,8-Tetrahydro-1,6-naphthyridin-3-amine: (1)ACD/BCF (pH 5.5): 1; (2)ACD/BCF (pH 7.4): 1; (3)ACD/KOC (pH 5.5): 1; (4)ACD/KOC (pH 7.4): 2.51; (5)#H bond acceptors: 3; (6)#H bond donors: 3; (7)#Freely Rotating Bonds: 1; (8)Index of Refraction: 1.606; (9)Molar Refractivity: 44.1 cm³; (10)Molar Volume: 127.7 cm³; (11)Surface Tension: 53.9 dyne/cm; (12)Density: 1.167 g/cm³; (13)Flash Point: 170.5 °C; (14)Enthalpy of Vaporization: 60.38 kJ/mol; (15)Boiling Point: 358.3 °C at 760 mmHg; (16)Vapour Pressure: 2.56E-05 mmHg at 25°C.

You can still convert the following datas into molecular structure:
(1)SMILES: c1c(cnc2c1CNCC2)N
(2)InChI: InChI=1/C8H11N3/c9-7-3-6-4-10-2-1-8(6)11-5-7/h3,5,10H,1-2,4,9H2
(3)InChIKey: MANOVAGPFVXCPN-UHFFFAOYAV