The 5-Carboxy-2-fluorophenylboronic acid with its CAS register number is 874219-59-7. It also can be called as 2-Fluoro-5-carboxybenzeneboronic acid and the systematic name about this chemical is 3-(dihydroxyboranyl)-4-fluorobenzoic acid. It belongs to the following product categories, such as blocks, BoronicAcids, Carboxes, FluoroCompounds, Aryl, Organoborons and so on.

Physical properties about 5-Carboxy-2-fluorophenylboronic acid are: (1)ACD/LogP: 1.13; (2)ACD/BCF (pH 5.5): 1; (3)ACD/BCF (pH 7.4): 1; (4)ACD/KOC (pH 5.5): 2; (5)ACD/KOC (pH 7.4): 1; (6)#H bond acceptors: 4; (7)#H bond donors: 3; (8)#Freely Rotating Bonds: 4; (9)Polar Surface Area: 77.76Ų; (10)Index of Refraction: 1.56; (11)Molar Refractivity: 39.677 cm³; (12)Molar Volume: 122.765 cm³; (13)Polarizability: 15.729x10^-24cm³; (14)Surface Tension: 58.502 dyne/cm; (15)Enthalpy of Vaporization: 72.6 kJ/mol.

You can still convert the following datas into molecular structure:
(1)SMILES: OB(O)c1cc(ccc1F)C(O)=O
(2)InChI: InChI=1/C7H6BFO4/c9-6-2-1-4(7(10)11)3-5(6)8(12)13/h1-3,12-13H,(H,10,11)
(3)InChIKey: YLZPFWJYAFZZHF-UHFFFAOYAP
(4)Std. InChI: InChI=1S/C7H6BFO4/c9-6-2-1-4(7(10)11)3-5(6)8(12)13/h1-3,12-13H,(H,10,11)
(5)Std. InChIKey: YLZPFWJYAFZZHF-UHFFFAOYSA-N