The Boronic acid, B-(5-fluoro-2-methoxy-4-pyridinyl)- is an organic compound with the formula C₆H₇BFNO₃. The IUPAC name of this chemical is (5-fluoro-2-methoxypyridin-4-yl)boronic acid. With the CAS registry number 1043869-98-2, it is also named as 5-Fluoro-2-methoxypyridine-4-boronic acid. The product's categories are Organoborons; Pyridine.  

The other characteristics of Boronic acid, B-(5-fluoro-2-methoxy-4-pyridinyl)- can be summarized as: (1)ACD/LogP: 0.81; (2)# of Rule of 5 Violations: 0; (3)#H bond acceptors: 4; (4)#H bond donors: 2; (5)#Freely Rotating Bonds: 4; (6)Polar Surface Area: 62.58 Å²; (7)Index of Refraction: 1.502; (8)Molar Refractivity: 37.56 cm³; (9)Molar Volume: 127.2 cm³; (10)Polarizability: 14.89×10^-24 cm³; (11)Surface Tension: 47 dyne/cm; (12)Enthalpy of Vaporization: 59.69 kJ/mol; (13)Vapour Pressure: 0.000107 mmHg at 25°C; (14)Rotatable Bond Count: 2; (15)Exact Mass: 171.050302; (16)MonoIsotopic Mass: 171.050302; (17)Topological Polar Surface Area: 62.6; (18)Heavy Atom Count: 12; (19)Complexity: 149.

People can use the following data to convert to the molecule structure.
1. SMILES:B(c1cc(ncc1F)OC)(O)O
2. InChI:InChI=1/C6H7BFNO3/c1-12-6-2-4(7(10)11)5(8)3-9-6/h2-3,10-11H,1H3
3. InChIKey:VGPMZARHJYGFSE-UHFFFAOYAM
4. Std. InChI:InChI=1S/C6H7BFNO3/c1-12-6-2-4(7(10)11)5(8)3-9-6/h2-3,10-11H,1H3
5. Std. InChIKey:VGPMZARHJYGFSE-UHFFFAOYSA-N