The 5-tert-Butyl-2-hydrazino-6H-1,3,4-thiadizine, with the CAS registry number 158035-17-7, is also known as (5-tert-Butyl-6H-[1,3,4]thiadiazin-2-yl)hydrazine. This chemical's molecular formula is C₇H₁₄N₄S and molecular weight is 186.28. Its systematic name is called 5-tert-butyl-2-hydrazino-6H-1,3,4-thiadiazine.

Physical properties of 5-tert-Butyl-2-hydrazino-6H-1,3,4-thiadizine: (1)ACD/LogP: 1.54; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 5.5): -2; (4)ACD/LogD (pH 7.4): -1; (5)ACD/BCF (pH 5.5): 1; (6)ACD/BCF (pH 7.4): 1; (7)ACD/KOC (pH 5.5): 1; (8)ACD/KOC (pH 7.4): 4; (9)#H bond acceptors: 4; (10)#H bond donors: 3; (11)#Freely Rotating Bonds: 2; (12)Index of Refraction: 1.624; (13)Molar Refractivity: 51.118 cm³; (14)Molar Volume: 144.858 cm³; (15)Surface Tension: 46.412 dyne/cm; (16)Density: 1.286 g/cm³; (17)Flash Point: 130.041 °C; (18)Enthalpy of Vaporization: 53.085 kJ/mol; (19)Boiling Point: 291.412 °C at 760 mmHg; (20)Vapour Pressure: 0.002 mmHg at 25°C.

You can still convert the following datas into molecular structure:
(1)SMILES: N=1\N=C(/SCC=1C(C)(C)C)NN
(2)InChI: InChI=1/C7H14N4S/c1-7(2,3)5-4-12-6(9-8)11-10-5/h4,8H2,1-3H3,(H,9,11)
(3)InChIKey: JSYWCHPLHXPDFM-UHFFFAOYAM