The 6-Chloro-3-nitroso-2-phenylimidazo[1,2-b]pyridazine, with the CAS registry number 483367-60-8, is also known as Imidazo[1,2-b]pyridazine, 6-chloro-3-nitroso-2-phenyl-. This chemical's molecular formula is C₁₂H₇ClN₄O and formula weight is 258.66. What's more, its systematic name is called 6-chloro-3-nitroso-2-phenylimidazo[1,2-b]pyridazine.

Physical properties of 6-Chloro-3-nitroso-2-phenylimidazo[1,2-b]pyridazine: (1)ACD/LogP: 3.37; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 5.5): 3.37; (4)ACD/LogD (pH 7.4): 3.37; (5)ACD/BCF (pH 5.5): 215.01; (6)ACD/BCF (pH 7.4): 215.01; (7)ACD/KOC (pH 5.5): 1626.24; (8)ACD/KOC (pH 7.4): 1626.24; (9)#H bond acceptors: 5; (10)#H bond donors: 0; (11)#Freely Rotating Bonds: 2; (12)Index of Refraction: 1.732; (13)Molar Refractivity: 68.77 cm³; (14)Molar Volume: 171.8 cm³; (15)Surface Tension: 61.5 dyne/cm; (16)Density: 1.5 g/cm³.

You can still convert the following datas into molecular structure:
(1)SMILES: Clc1nn2c(N=O)c(nc2cc1)c3ccccc3
(2)InChI: InChI=1/C12H7ClN4O/c13-9-6-7-10-14-11(8-4-2-1-3-5-8)12(16-18)17(10)15-9/h1-7H
(3)InChIKey: GVRDUSIHVXSLBE-UHFFFAOYAZ