The CAS register number of 6H-Dipyrido[1,2-a:2',1'-c][1,4]diazepinediium,7,8-dihydro-, bromide (1:2) is 2895-98-9. It also can be called as 1,1'-Propylene-2,2'-bipyridyliumdibromide and the systematic name about this chemical is 7,8-dihydro-6H-dipyrido[1,2-a:2',1'-c][1,4]diazepinediium dibromide. The molecular formula about this chemical is C₁₃H₁₄Br₂N₂ and the molecular weight is 358.07.

Physical properties about 6H-Dipyrido[1,2-a:2',1'-c][1,4]diazepinediium,7,8-dihydro-, bromide (1:2) are: (1)ACD/LogP: -4.68; (2)ACD/LogD (pH 5.5): -4.68; (3)ACD/LogD (pH 7.4): -4.68; (4)ACD/BCF (pH 5.5): 1; (5)ACD/BCF (pH 7.4): 1; (6)ACD/KOC (pH 5.5): 1; (7)ACD/KOC (pH 7.4): 1; (8)#H bond acceptors: 2; (9)Polar Surface Area: 7.76 Å²; (10)Heavy Atom Count: 16; (11)Formal Charge: 1; (12)Complexity: 195; (13)Covalently-Bonded Unit Count: 2.

You can still convert the following datas into molecular structure:
(1)SMILES: [Br-].[Br-].c3ccc2c1[n+](cccc1)CCC[n+]2c3
(2)InChI: InChI=1/C13H14N2.2BrH/c1-3-8-14-10-5-11-15-9-4-2-7-13(15)12(14)6-1;;/h1-4,6-9H,5,10-11H2;2*1H/q+2;;/p-2
(3)InChIKey: BMFRJCKQKSXVET-NUQVWONBAW
(4)Std. InChI: InChI=1S/C13H14N2.2BrH/c1-3-8-14-10-5-11-15-9-4-2-7-13(15)12(14)6-1;;/h1-4,6-9H,5,10-11H2;2*1H/q+2;;/p-2
(5)Std. InChIKey: BMFRJCKQKSXVET-UHFFFAOYSA-L