The 9,10-Dithiaphenanthrene, with the CAS registry number 230-26-2, is also known as 2,2'-Biphenyl disulfide. This chemical's molecular formula is C₁₂H₈S₂ and molecular weight is 216.3219. Its systematic name is called dibenzo[c,e][1,2]dithiine.

Physical properties of 9,10-Dithiaphenanthrene: (1)ACD/LogP: 4.60; (2)ACD/LogD (pH 5.5): 4.6; (3)ACD/LogD (pH 7.4): 4.6; (4)ACD/BCF (pH 5.5): 1852.01; (5)ACD/BCF (pH 7.4): 1852.01; (6)ACD/KOC (pH 5.5): 7595.85; (7)ACD/KOC (pH 7.4): 7595.85; (8)Index of Refraction: 1.724; (9)Molar Refractivity: 65.5 cm³; (10)Molar Volume: 165 cm³; (11)Surface Tension: 59.2 dyne/cm; (12)Density: 1.31 g/cm³; (13)Flash Point: 240.9 °C; (14)Enthalpy of Vaporization: 56.56 kJ/mol; (15)Boiling Point: 344.9 °C at 760 mmHg; (16)Vapour Pressure: 0.000127 mmHg at 25°C.

You can still convert the following datas into molecular structure:
(1)SMILES: S2Sc1ccccc1c3c2cccc3
(2)InChI: InChI=1/C12H8S2/c1-3-7-11-9(5-1)10-6-2-4-8-12(10)14-13-11/h1-8H
(3)InChIKey: GYVHEQGWDJVMAU-UHFFFAOYAK