The Acetylacetonatobis(2-phenylpyridine)iridium, with the CAS registry number 337526-85-9, is also known as Ir(ppy)2(acac), Acetylacetonatobis(2-phenylpyridine)iridium. It belongs to the product categories of Oled Materials; Fine Chemicals, Specialty Chemicals, Intermediates, Electronic Chemical, Organic Synthesis, Functional Materials. This chemical's molecular formula is C₂₇H₂₃IrN₂O₂ and molecular weight is 599.71. What's more, both its IUPAC name and systematic name are the same which is called Bis(2-phenylpyridine)(acetylacetonate)iridium(III).

Physical properties about Acetylacetonatobis(2-phenylpyridine)iridium are: (1)#H bond acceptors: 4; (2)#H bond donors: 0; (3)#Freely Rotating Bonds: 7; (4)Polar Surface Area: 52.08 Å².

You can still convert the following datas into molecular structure:
(1) SMILES: C/C(=C/C(=O)C)/O[Ir](c1ccccc1c2ccccn2)c3ccccc3c4ccccn4
(2) InChI: InChI=1S/2C11H8N.C5H8O2.Ir/c2*1-2-6-10(7-3-1)11-8-4-5-9-12-11;1-4(6)3-5(2)7;/h2*1-6,8-9H;3,6H,1-2H3;/q;;;+1/p-1/b;;4-3-;
(3) InChIKey: QISLNNOQKUEVTI-DVACKJPTSA-M