The CAS registry number of Benzamide,2,3-dihydroxy-N-(2-hydroxyethyl)- is 29597-83-9. Its EINECS registry number is 249-718-8. This chemical's molecular formula is C₉H₁₁NO₄ and molecular weight is 197.18794. What's more, its systematic name is 2,3-Dihydroxy-N-(2-hydroxyethyl)benzamide.

Physical properties about Benzamide,2,3-dihydroxy-N-(2-hydroxyethyl)- are: (1)ACD/LogP: 0.50; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 5.5): 0.49; (4)ACD/LogD (pH 7.4): 0.39; (5)ACD/BCF (pH 5.5): 1.4; (6)ACD/BCF (pH 7.4): 1.09; (7)ACD/KOC (pH 5.5): 44.16; (8)ACD/KOC (pH 7.4): 34.48; (9)#H bond acceptors: 5; (10)#H bond donors: 4; (11)#Freely Rotating Bonds: 6; (12)Polar Surface Area: 48 Å²; (13)Index of Refraction: 1.626; (14)Molar Refractivity: 49.8 cm³; (15)Molar Volume: 140.6 cm³; (16)Polarizability: 19.74×10^-24 cm³; (17)Surface Tension: 70 dyne/cm; (18)Density: 1.401 g/cm³; (19)Flash Point: 214.7 °C; (20)Enthalpy of Vaporization: 72.41 kJ/mol; (21)Boiling Point: 431.4 °C at 760 mmHg; (22)Vapour Pressure: 3.3E-08 mmHg at 25°C.

You can still convert the following datas into molecular structure:
(1)SMILES: O=C(c1cccc(O)c1O)NCCO
(2)InChI: InChI=1/C9H11NO4/c11-5-4-10-9(14)6-2-1-3-7(12)8(6)13/h1-3,11-13H,4-5H2,(H,10,14)
(3)InChIKey: NPGHQBAAQRJMAI-UHFFFAOYAR