The Benzamide,4-ethoxy-N,N-diethyl-, with the CAS registry number 67272-97-3, is also known as Benzamide, p-Ethoxy-N,N-diethyl-. This chemical's molecular formula is C₁₃H₁₉NO₂ and molecular weight is 221.2955. What's more, both its IUPAC name and systematic name are the same which is called 4-Ethoxy-N,N-diethylbenzamide.

Physical properties about Benzamide,4-ethoxy-N,N-diethyl- are: (1)ACD/LogP: 2.55; (2)# of Rule of 5 Violations: 0; (3)#H bond acceptors: 3; (4)#H bond donors: 0; (5)#Freely Rotating Bonds: 5; (6)Polar Surface Area: 29.54 Ų; (7)Index of Refraction: 1.509; (8)Molar Refractivity: 65.21 cm³; (9)Molar Volume: 218.2 cm³; (10)Polarizability: 25.85×10^-24 cm³; (11)Surface Tension: 35.8 dyne/cm; (12)Density: 1.013 g/cm³; (13)Flash Point: 169.7 °C; (14)Enthalpy of Vaporization: 60.24 kJ/mol; (15)Boiling Point: 357 °C at 760 mmHg; (16)Vapour Pressure: 2.81E-05 mmHg at 25 °C.

You can still convert the following datas into molecular structure:
(1)SMILES: O=C(c1ccc(OCC)cc1)N(CC)CC
(2)InChI: InChI=1/C13H19NO2/c1-4-14(5-2)13(15)11-7-9-12(10-8-11)16-6-3/h7-10H,4-6H2,1-3H3
(3)InChIKey: BNKLTZHPOPBYQP-UHFFFAOYAR