The Benzamide,N-[[(3,5-dichloro-2,4-difluorophenyl)amino]carbonyl]-2,6-difluoro-, with the CAS registry number 99039-56-2, is also known as Benzamide, N-(((3,5-dichloro-2,4-difluorophenyl)amino)carbonyl)-2,6-difluoro-. This chemical's molecular formula is C₁₄H₆Cl₂F₄N₂O₂ and molecular weight is 381.1093. Its systematic name is called N-[(3,5-dichloro-2,4-difluorophenyl)carbamoyl]-2,6-difluorobenzamide. This chemical's classification code is Insecticide.

Physical properties of Benzamide,N-[[(3,5-dichloro-2,4-difluorophenyl)amino]carbonyl]-2,6-difluoro-: (1)ACD/LogP: 5.49; (2)# of Rule of 5 Violations: 1; (3)ACD/LogD (pH 5.5): 5.48; (4)ACD/LogD (pH 7.4): 5.05; (5)ACD/BCF (pH 5.5): 8515.6; (6)ACD/BCF (pH 7.4): 3185.02; (7)ACD/KOC (pH 5.5): 22497.18; (8)ACD/KOC (pH 7.4): 8414.43; (9)#H bond acceptors: 4; (10)#H bond donors: 2; (11)#Freely Rotating Bonds: 2; (12)Index of Refraction: 1.596; (13)Molar Refractivity: 78.85 cm³; (14)Molar Volume: 231.4 cm³; (15)Surface Tension: 51.4 dyne/cm; (16)Density: 1.646 g/cm³.

You can still convert the following datas into molecular structure:
(1)SMILES: Clc1cc(c(F)c(Cl)c1F)NC(=O)NC(=O)c2c(F)cccc2F
(2)InChI: InChI=1/C14H6Cl2F4N2O2/c15-5-4-8(12(20)10(16)11(5)19)21-14(24)22-13(23)9-6(17)2-1-3-7(9)18/h1-4H,(H2,21,22,23,24)
(3)InChIKey: CJDWRQLODFKPEL-UHFFFAOYAH